C16H13ClO5 — CID 11809394
2-chloro-1-hydroxy-5,8-dimethoxy-6-methylxanthen-9-one (PubChem CID 11809394) has the molecular formula C16H13ClO5 and a molecular weight of 320.73 g/mol. Its IUPAC name is 2-chloro-1-hydroxy-5,8-dimethoxy-6-methylxanthen-9-one.
| Compound Name | 2-chloro-1-hydroxy-5,8-dimethoxy-6-methylxanthen-9-one |
|---|---|
| PubChem CID | 11809394 |
| Molecular Formula | C16H13ClO5 |
| Molecular Weight | 320.73 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-chloro-1-hydroxy-5,8-dimethoxy-6-methylxanthen-9-one |
| SMILES | COc1c(C)cc(OC)c2c(=O)c3c(O)c(Cl)ccc3oc12 |
| InChI | InChI=1S/C16H13ClO5/c1-7-6-10(20-2)12-14(19)11-9(5-4-8(17)13(11)18)22-16(12)15(7)21-3/h4-6,18H,1-3H3 |
| InChIKey | WALGTXKIVNMFQE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.73 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|