C16H14O6 — CID 162882586
1-hydroxy-3,4,8-trimethoxyxanthen-9-one (PubChem CID 162882586) has the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. Its IUPAC name is 1-hydroxy-3,4,8-trimethoxyxanthen-9-one.
| Compound Name | 1-hydroxy-3,4,8-trimethoxyxanthen-9-one |
|---|---|
| PubChem CID | 162882586 |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 1-hydroxy-3,4,8-trimethoxyxanthen-9-one |
| SMILES | COc1cc(O)c2c(=O)c3c(OC)cccc3oc2c1OC |
| InChI | InChI=1S/C16H14O6/c1-19-9-5-4-6-10-13(9)14(18)12-8(17)7-11(20-2)15(21-3)16(12)22-10/h4-7,17H,1-3H3 |
| InChIKey | UCRWOIYPAVUBCV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|