C15H12O7 — CID 86183532
1,5,8-trihydroxy-3,4-dimethoxyxanthen-9-one (PubChem CID 86183532) has the molecular formula C15H12O7 and a molecular weight of 304.25 g/mol. Its IUPAC name is 1,5,8-trihydroxy-3,4-dimethoxyxanthen-9-one.
| Compound Name | 1,5,8-trihydroxy-3,4-dimethoxyxanthen-9-one |
|---|---|
| PubChem CID | 86183532 |
| Molecular Formula | C15H12O7 |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 1,5,8-trihydroxy-3,4-dimethoxyxanthen-9-one |
| SMILES | COc1cc(O)c2c(=O)c3c(O)ccc(O)c3oc2c1OC |
| InChI | InChI=1S/C15H12O7/c1-20-9-5-8(18)11-12(19)10-6(16)3-4-7(17)13(10)22-15(11)14(9)21-2/h3-5,16-18H,1-2H3 |
| InChIKey | ZXGKYKCGVKMAQK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|