C19H18O8 — CID 57384568
(2S,3S)-3,6,9-trihydroxy-2-(2-hydroxypropan-2-yl)-11-methoxy-2,3-dihydrofuro[3,2-b]xanthen-5-one (PubChem CID 57384568) has the molecular formula C19H18O8 and a molecular weight of 374.35 g/mol. Its IUPAC name is (2S,3S)-3,6,9-trihydroxy-2-(2-hydroxypropan-2-yl)-11-methoxy-2,3-dihydrofuro[3,2-b]xanthen-5-one.
| Compound Name | (2S,3S)-3,6,9-trihydroxy-2-(2-hydroxypropan-2-yl)-11-methoxy-2,3-dihydrofuro[3,2-b]xanthen-5-one |
|---|---|
| PubChem CID | 57384568 |
| Molecular Formula | C19H18O8 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | (2S,3S)-3,6,9-trihydroxy-2-(2-hydroxypropan-2-yl)-11-methoxy-2,3-dihydrofuro[3,2-b]xanthen-5-one |
| SMILES | COc1c2c(cc3c(=O)c4c(O)ccc(O)c4oc13)[C@H](O)[C@@H](C(C)(C)O)O2 |
| InChI | InChI=1S/C19H18O8/c1-19(2,24)18-13(23)8-6-7-12(22)11-9(20)4-5-10(21)16(11)26-14(7)17(25-3)15(8)27-18/h4-6,13,18,20-21,23-24H,1-3H3/t13-,18-/m0/s1 |
| InChIKey | LPHBNAQIPRDJFD-UGSOOPFHSA-N |
| XLogP | 1.93 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|