C20H16O7 — CID 122177580
(5S,6S)-5,16-dihydroxy-6-(2-hydroxypropan-2-yl)-7,11,19-trioxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13(18),14,16-heptaen-20-one (PubChem CID 122177580) has the molecular formula C20H16O7 and a molecular weight of 368.34 g/mol. Its IUPAC name is (5S,6S)-5,16-dihydroxy-6-(2-hydroxypropan-2-yl)-7,11,19-trioxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13(18),14,16-heptaen-20-one.
| Compound Name | (5S,6S)-5,16-dihydroxy-6-(2-hydroxypropan-2-yl)-7,11,19-trioxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13(18),14,16-heptaen-20-one |
|---|---|
| PubChem CID | 122177580 |
| Molecular Formula | C20H16O7 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | (5S,6S)-5,16-dihydroxy-6-(2-hydroxypropan-2-yl)-7,11,19-trioxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13(18),14,16-heptaen-20-one |
| SMILES | CC(C)(O)[C@H]1Oc2cc3oc4c5ccc(O)cc5oc(=O)c4c3cc2[C@@H]1O |
| InChI | InChI=1S/C20H16O7/c1-20(2,24)18-16(22)11-6-10-13(7-14(11)26-18)25-17-9-4-3-8(21)5-12(9)27-19(23)15(10)17/h3-7,16,18,21-22,24H,1-2H3/t16-,18-/m0/s1 |
| InChIKey | ZJBOZZWXWWQLRJ-WMZOPIPTSA-N |
| XLogP | 2.96 |
| TPSA | 113.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|