C15H7NO6 — CID 169315990
8-hydroxy-3-nitro-[1]benzofuro[3,2-c]chromen-6-one (PubChem CID 169315990) has the molecular formula C15H7NO6 and a molecular weight of 297.22 g/mol. Its IUPAC name is 8-hydroxy-3-nitro-[1]benzofuro[3,2-c]chromen-6-one.
| Compound Name | 8-hydroxy-3-nitro-[1]benzofuro[3,2-c]chromen-6-one |
|---|---|
| PubChem CID | 169315990 |
| Molecular Formula | C15H7NO6 |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 8-hydroxy-3-nitro-[1]benzofuro[3,2-c]chromen-6-one |
| SMILES | O=c1oc2cc([N+](=O)[O-])ccc2c2oc3ccc(O)cc3c12 |
| InChI | InChI=1S/C15H7NO6/c17-8-2-4-11-10(6-8)13-14(21-11)9-3-1-7(16(19)20)5-12(9)22-15(13)18/h1-6,17H |
| InChIKey | LMPNHMHDMSLPRC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|