C19H13NO5 — CID 174151009
6-oxo-8-(prop-1-en-2-ylamino)-[1]benzofuro[3,2-c]chromene-3-carboxylic acid (PubChem CID 174151009) has the molecular formula C19H13NO5 and a molecular weight of 335.32 g/mol. Its IUPAC name is 6-oxo-8-(prop-1-en-2-ylamino)-[1]benzofuro[3,2-c]chromene-3-carboxylic acid.
| Compound Name | 6-oxo-8-(prop-1-en-2-ylamino)-[1]benzofuro[3,2-c]chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 174151009 |
| Molecular Formula | C19H13NO5 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 6-oxo-8-(prop-1-en-2-ylamino)-[1]benzofuro[3,2-c]chromene-3-carboxylic acid |
| SMILES | C=C(C)Nc1ccc2oc3c4ccc(C(=O)O)cc4oc(=O)c3c2c1 |
| InChI | InChI=1S/C19H13NO5/c1-9(2)20-11-4-6-14-13(8-11)16-17(24-14)12-5-3-10(18(21)22)7-15(12)25-19(16)23/h3-8,20H,1H2,2H3,(H,21,22) |
| InChIKey | DRXXFOYYPNHWEI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|