About carbon dioxide;9-oxoxanthene-3-carboxylic acid
carbon dioxide;9-oxoxanthene-3-carboxylic acid (PubChem CID 158563906) has the molecular formula C15H8O6
and a molecular weight of 284.22 g/mol. Its IUPAC name is carbon dioxide;9-oxoxanthene-3-carboxylic acid.
Molecular Properties
| Compound Name | carbon dioxide;9-oxoxanthene-3-carboxylic acid |
| PubChem CID | 158563906 |
| Molecular Formula | C15H8O6 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | carbon dioxide;9-oxoxanthene-3-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(=O)c3ccccc3oc2c1.O=C=O |
| InChI | InChI=1S/C14H8O4.CO2/c15-13-9-3-1-2-4-11(9)18-12-7-8(14(16)17)5-6-10(12)13;2-1-3/h1-7H,(H,16,17); |
| InChIKey | HRFQDYFFRVCIHN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;9-oxoxanthene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;9-oxoxanthene-3-carboxylic acid?
The IUPAC name of carbon dioxide;9-oxoxanthene-3-carboxylic acid (CID 158563906) is carbon dioxide;9-oxoxanthene-3-carboxylic acid.
What is the SMILES notation for carbon dioxide;9-oxoxanthene-3-carboxylic acid?
The canonical SMILES for carbon dioxide;9-oxoxanthene-3-carboxylic acid is O=C(O)c1ccc2c(=O)c3ccccc3oc2c1.O=C=O.
What is the InChIKey of carbon dioxide;9-oxoxanthene-3-carboxylic acid?
The InChIKey is HRFQDYFFRVCIHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O4.CO2/c15-13-9-3-1-2-4-11(9)18-12-7-8(14(16)17)5-6-10(12)13;2-1-3/h1-7H,(H,16,17);.
What are the key properties of carbon dioxide;9-oxoxanthene-3-carboxylic acid?
carbon dioxide;9-oxoxanthene-3-carboxylic acid has a molecular weight of 284.22 g/mol, XLogP of 2.06, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;9-oxoxanthene-3-carboxylic acid is sourced from PubChem (CID 158563906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).