C13H7NO4 — CID 121468128
5-oxochromeno[2,3-c]pyridine-7-carboxylic acid (PubChem CID 121468128) has the molecular formula C13H7NO4 and a molecular weight of 241.20 g/mol. Its IUPAC name is 5-oxochromeno[2,3-c]pyridine-7-carboxylic acid.
| Compound Name | 5-oxochromeno[2,3-c]pyridine-7-carboxylic acid |
|---|---|
| PubChem CID | 121468128 |
| Molecular Formula | C13H7NO4 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 5-oxochromeno[2,3-c]pyridine-7-carboxylic acid |
| SMILES | O=C(O)c1ccc2oc3cnccc3c(=O)c2c1 |
| InChI | InChI=1S/C13H7NO4/c15-12-8-3-4-14-6-11(8)18-10-2-1-7(13(16)17)5-9(10)12/h1-6H,(H,16,17) |
| InChIKey | YRDUWGCGCCLUHI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|