5-oxochromeno[2,3-c]pyridine-7-carboxylic acid

C13H7NO4 — CID 121468128

IUPAC5-oxochromeno[2,3-c]pyridine-7-carboxylic acid
SMILESO=C(O)c1ccc2oc3cnccc3c(=O)c2c1
InChIInChI=1S/C13H7NO4/c15-12-8-3-4-14-6-11(8)18-10-2-1-7(13(16)17)5-9(10)12/h1-6H,(H,16,17)
InChIKeyYRDUWGCGCCLUHI-UHFFFAOYSA-N
MW241.20 g/mol
LogP2.04
Rot. Bonds1

About 5-oxochromeno[2,3-c]pyridine-7-carboxylic acid

5-oxochromeno[2,3-c]pyridine-7-carboxylic acid (PubChem CID 121468128) has the molecular formula C13H7NO4 and a molecular weight of 241.20 g/mol. Its IUPAC name is 5-oxochromeno[2,3-c]pyridine-7-carboxylic acid.

Molecular Properties

Compound Name5-oxochromeno[2,3-c]pyridine-7-carboxylic acid
PubChem CID121468128
Molecular FormulaC13H7NO4
Molecular Weight241.20 g/mol
Exact Mass241.04
IUPAC Name5-oxochromeno[2,3-c]pyridine-7-carboxylic acid
SMILESO=C(O)c1ccc2oc3cnccc3c(=O)c2c1
InChIInChI=1S/C13H7NO4/c15-12-8-3-4-14-6-11(8)18-10-2-1-7(13(16)17)5-9(10)12/h1-6H,(H,16,17)
InChIKeyYRDUWGCGCCLUHI-UHFFFAOYSA-N
XLogP2.04
TPSA80.40 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.20
LogP ≤ 52.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}

Analyze 5-oxochromeno[2,3-c]pyridine-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-oxochromeno[2,3-c]pyridine-7-carboxylic acid?
The IUPAC name of 5-oxochromeno[2,3-c]pyridine-7-carboxylic acid (CID 121468128) is 5-oxochromeno[2,3-c]pyridine-7-carboxylic acid.
What is the SMILES notation for 5-oxochromeno[2,3-c]pyridine-7-carboxylic acid?
The canonical SMILES for 5-oxochromeno[2,3-c]pyridine-7-carboxylic acid is O=C(O)c1ccc2oc3cnccc3c(=O)c2c1.
What is the InChIKey of 5-oxochromeno[2,3-c]pyridine-7-carboxylic acid?
The InChIKey is YRDUWGCGCCLUHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7NO4/c15-12-8-3-4-14-6-11(8)18-10-2-1-7(13(16)17)5-9(10)12/h1-6H,(H,16,17).
What are the key properties of 5-oxochromeno[2,3-c]pyridine-7-carboxylic acid?
5-oxochromeno[2,3-c]pyridine-7-carboxylic acid has a molecular weight of 241.20 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxochromeno[2,3-c]pyridine-7-carboxylic acid is sourced from PubChem (CID 121468128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).