5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid

C22H24O4 — CID 12825848

IUPAC5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid
SMILESCC(C)(C)c1cc(C(C)(C)C)c2oc3ccc(C(=O)O)cc3c(=O)c2c1
InChIInChI=1S/C22H24O4/c1-21(2,3)13-10-15-18(23)14-9-12(20(24)25)7-8-17(14)26-19(15)16(11-13)22(4,5)6/h7-11H,1-6H3,(H,24,25)
InChIKeyDNEQKAFNLIPAOE-UHFFFAOYSA-N
MW352.43 g/mol
LogP5.24
Rot. Bonds1

About 5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid

5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid (PubChem CID 12825848) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is 5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid.

Molecular Properties

Compound Name5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid
PubChem CID12825848
Molecular FormulaC22H24O4
Molecular Weight352.43 g/mol
Exact Mass352.17
IUPAC Name5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid
SMILESCC(C)(C)c1cc(C(C)(C)C)c2oc3ccc(C(=O)O)cc3c(=O)c2c1
InChIInChI=1S/C22H24O4/c1-21(2,3)13-10-15-18(23)14-9-12(20(24)25)7-8-17(14)26-19(15)16(11-13)22(4,5)6/h7-11H,1-6H3,(H,24,25)
InChIKeyDNEQKAFNLIPAOE-UHFFFAOYSA-N
XLogP5.24
TPSA67.51 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms26
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500352.43
LogP ≤ 55.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}

Analyze 5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid?
The IUPAC name of 5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid (CID 12825848) is 5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid.
What is the SMILES notation for 5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid?
The canonical SMILES for 5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid is CC(C)(C)c1cc(C(C)(C)C)c2oc3ccc(C(=O)O)cc3c(=O)c2c1.
What is the InChIKey of 5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid?
The InChIKey is DNEQKAFNLIPAOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24O4/c1-21(2,3)13-10-15-18(23)14-9-12(20(24)25)7-8-17(14)26-19(15)16(11-13)22(4,5)6/h7-11H,1-6H3,(H,24,25).
What are the key properties of 5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid?
5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid has a molecular weight of 352.43 g/mol, XLogP of 5.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid is sourced from PubChem (CID 12825848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).