C22H24O4 — CID 12825848
5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid (PubChem CID 12825848) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is 5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid.
| Compound Name | 5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid |
|---|---|
| PubChem CID | 12825848 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 5,7-ditert-butyl-9-oxoxanthene-2-carboxylic acid |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2oc3ccc(C(=O)O)cc3c(=O)c2c1 |
| InChI | InChI=1S/C22H24O4/c1-21(2,3)13-10-15-18(23)14-9-12(20(24)25)7-8-17(14)26-19(15)16(11-13)22(4,5)6/h7-11H,1-6H3,(H,24,25) |
| InChIKey | DNEQKAFNLIPAOE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|