C21H24O2 — CID 10859809
2,7-ditert-butylxanthen-9-one (PubChem CID 10859809) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is 2,7-ditert-butylxanthen-9-one.
| Compound Name | 2,7-ditert-butylxanthen-9-one |
|---|---|
| PubChem CID | 10859809 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 2,7-ditert-butylxanthen-9-one |
| SMILES | CC(C)(C)c1ccc2oc3ccc(C(C)(C)C)cc3c(=O)c2c1 |
| InChI | InChI=1S/C21H24O2/c1-20(2,3)13-7-9-17-15(11-13)19(22)16-12-14(21(4,5)6)8-10-18(16)23-17/h7-12H,1-6H3 |
| InChIKey | RGTOTJAQEZOESF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|