C28H26O2 — CID 11784207
3,9-ditert-butylindeno[1,2-b]fluorene-6,12-dione (PubChem CID 11784207) has the molecular formula C28H26O2 and a molecular weight of 394.51 g/mol. Its IUPAC name is 3,9-ditert-butylindeno[1,2-b]fluorene-6,12-dione.
| Compound Name | 3,9-ditert-butylindeno[1,2-b]fluorene-6,12-dione |
|---|---|
| PubChem CID | 11784207 |
| Molecular Formula | C28H26O2 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 3,9-ditert-butylindeno[1,2-b]fluorene-6,12-dione |
| SMILES | CC(C)(C)c1ccc2c(=O)c3cc4c(cc3c2c1)c(=O)c1ccc(C(C)(C)C)cc14 |
| InChI | InChI=1S/C28H26O2/c1-27(2,3)15-7-9-17-19(11-15)21-13-24-22(14-23(21)25(17)29)20-12-16(28(4,5)6)8-10-18(20)26(24)30/h7-14H,1-6H3 |
| InChIKey | BIHRSFDYGOMIRR-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |