C42H34O6 — CID 86088016
2,9-bis(4-tert-butylphenoxy)pentacene-5,7,12,14-tetrone (PubChem CID 86088016) has the molecular formula C42H34O6 and a molecular weight of 634.73 g/mol. Its IUPAC name is 2,9-bis(4-tert-butylphenoxy)pentacene-5,7,12,14-tetrone.
| Compound Name | 2,9-bis(4-tert-butylphenoxy)pentacene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 86088016 |
| Molecular Formula | C42H34O6 |
| Molecular Weight | 634.73 g/mol |
| Exact Mass | 634.24 |
| IUPAC Name | 2,9-bis(4-tert-butylphenoxy)pentacene-5,7,12,14-tetrone |
| SMILES | CC(C)(C)c1ccc(Oc2ccc3c(=O)c4cc5c(=O)c6cc(Oc7ccc(C(C)(C)C)cc7)ccc6c(=O)c5cc4c(=O)c3c2)cc1 |
| InChI | InChI=1S/C42H34O6/c1-41(2,3)23-7-11-25(12-8-23)47-27-15-17-29-31(19-27)39(45)35-21-34-36(22-33(35)37(29)43)40(46)32-20-28(16-18-30(32)38(34)44)48-26-13-9-24(10-14-26)42(4,5)6/h7-22H,1-6H3 |
| InChIKey | PGQQHKFHCBZXJT-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.73 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|