C16H10O5 — CID 58803270
5-(4-methoxyphenoxy)indene-1,2,3-trione (PubChem CID 58803270) has the molecular formula C16H10O5 and a molecular weight of 282.25 g/mol. Its IUPAC name is 5-(4-methoxyphenoxy)indene-1,2,3-trione.
| Compound Name | 5-(4-methoxyphenoxy)indene-1,2,3-trione |
|---|---|
| PubChem CID | 58803270 |
| Molecular Formula | C16H10O5 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 5-(4-methoxyphenoxy)indene-1,2,3-trione |
| SMILES | COc1ccc(Oc2ccc3c(=O)c(=O)c(=O)c3c2)cc1 |
| InChI | InChI=1S/C16H10O5/c1-20-9-2-4-10(5-3-9)21-11-6-7-12-13(8-11)15(18)16(19)14(12)17/h2-8H,1H3 |
| InChIKey | LVTJFFOSCOBXQQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|