C34H24N2O6 — CID 139788379
3,10-bis(4-methoxyphenoxy)-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (PubChem CID 139788379) has the molecular formula C34H24N2O6 and a molecular weight of 556.57 g/mol. Its IUPAC name is 3,10-bis(4-methoxyphenoxy)-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 3,10-bis(4-methoxyphenoxy)-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 139788379 |
| Molecular Formula | C34H24N2O6 |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | 3,10-bis(4-methoxyphenoxy)-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
| SMILES | COc1ccc(Oc2ccc3c(=O)c4cc5[nH]c6cc(Oc7ccc(OC)cc7)ccc6c(=O)c5cc4[nH]c3c2)cc1 |
| InChI | InChI=1S/C34H24N2O6/c1-39-19-3-7-21(8-4-19)41-23-11-13-25-29(15-23)35-31-17-28-32(18-27(31)33(25)37)36-30-16-24(12-14-26(30)34(28)38)42-22-9-5-20(40-2)6-10-22/h3-18H,1-2H3,(H,35,37)(H,36,38) |
| InChIKey | DHQDFKZOJDBOLO-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|