C30H28N2O4 — CID 139781786
3,8-diethyl-2,7-bis(4-methoxyphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione (PubChem CID 139781786) has the molecular formula C30H28N2O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is 3,8-diethyl-2,7-bis(4-methoxyphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione.
| Compound Name | 3,8-diethyl-2,7-bis(4-methoxyphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione |
|---|---|
| PubChem CID | 139781786 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 3,8-diethyl-2,7-bis(4-methoxyphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione |
| SMILES | CCc1c(-c2ccc(OC)cc2)[nH]c2cc3c(=O)c(CC)c(-c4ccc(OC)cc4)[nH]c3cc2c1=O |
| InChI | InChI=1S/C30H28N2O4/c1-5-21-27(17-7-11-19(35-3)12-8-17)31-25-16-24-26(15-23(25)29(21)33)32-28(22(6-2)30(24)34)18-9-13-20(36-4)14-10-18/h7-16H,5-6H2,1-4H3,(H,31,33)(H,32,34) |
| InChIKey | YZZXSHZRWATHQR-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|