About CID 159077909
CID 159077909 (PubChem CID 159077909) has the molecular formula C27H25B2NO3
and a molecular weight of 433.13 g/mol.
Molecular Properties
| Compound Name | CID 159077909 |
| PubChem CID | 159077909 |
| Molecular Formula | C27H25B2NO3 |
| Molecular Weight | 433.13 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | — |
| SMILES | [B]c1cc(CCC(C)=O)cc([B])c1Oc1ccc2[nH]c(-c3ccc(OC)cc3)c(CC)c2c1 |
| InChI | InChI=1S/C27H25B2NO3/c1-4-21-22-15-20(33-27-23(28)13-17(14-24(27)29)6-5-16(2)31)11-12-25(22)30-26(21)18-7-9-19(32-3)10-8-18/h7-15,30H,4-6H2,1-3H3 |
| InChIKey | PJJQCMOVGSAIDP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.13 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 159077909 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159077909?
The IUPAC name of CID 159077909 (CID 159077909) is not available.
What is the SMILES notation for CID 159077909?
The canonical SMILES for CID 159077909 is [B]c1cc(CCC(C)=O)cc([B])c1Oc1ccc2[nH]c(-c3ccc(OC)cc3)c(CC)c2c1.
What is the InChIKey of CID 159077909?
The InChIKey is PJJQCMOVGSAIDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25B2NO3/c1-4-21-22-15-20(33-27-23(28)13-17(14-24(27)29)6-5-16(2)31)11-12-25(22)30-26(21)18-7-9-19(32-3)10-8-18/h7-15,30H,4-6H2,1-3H3.
What are the key properties of CID 159077909?
CID 159077909 has a molecular weight of 433.13 g/mol, XLogP of 4.31, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159077909 is sourced from PubChem (CID 159077909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).