C27H25B2NO3 — CID 159077909
CID 159077909 (PubChem CID 159077909) has the molecular formula C27H25B2NO3 and a molecular weight of 433.13 g/mol.
| Compound Name | CID 159077909 |
|---|---|
| PubChem CID | 159077909 |
| Molecular Formula | C27H25B2NO3 |
| Molecular Weight | 433.13 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | — |
| SMILES | [B]c1cc(CCC(C)=O)cc([B])c1Oc1ccc2[nH]c(-c3ccc(OC)cc3)c(CC)c2c1 |
| InChI | InChI=1S/C27H25B2NO3/c1-4-21-22-15-20(33-27-23(28)13-17(14-24(27)29)6-5-16(2)31)11-12-25(22)30-26(21)18-7-9-19(32-3)10-8-18/h7-15,30H,4-6H2,1-3H3 |
| InChIKey | PJJQCMOVGSAIDP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.13 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|