C22H19NO — CID 11278424
4-(2-naphthalen-2-yl-1H-indol-3-yl)butan-2-one (PubChem CID 11278424) has the molecular formula C22H19NO and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-(2-naphthalen-2-yl-1H-indol-3-yl)butan-2-one.
| Compound Name | 4-(2-naphthalen-2-yl-1H-indol-3-yl)butan-2-one |
|---|---|
| PubChem CID | 11278424 |
| Molecular Formula | C22H19NO |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 4-(2-naphthalen-2-yl-1H-indol-3-yl)butan-2-one |
| SMILES | CC(=O)CCc1c(-c2ccc3ccccc3c2)[nH]c2ccccc12 |
| InChI | InChI=1S/C22H19NO/c1-15(24)10-13-20-19-8-4-5-9-21(19)23-22(20)18-12-11-16-6-2-3-7-17(16)14-18/h2-9,11-12,14,23H,10,13H2,1H3 |
| InChIKey | VHPKRSYBZCPLDA-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |