C38H24N2O5 — CID 139788390
2,4,9-triphenoxy-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (PubChem CID 139788390) has the molecular formula C38H24N2O5 and a molecular weight of 588.62 g/mol. Its IUPAC name is 2,4,9-triphenoxy-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 2,4,9-triphenoxy-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 139788390 |
| Molecular Formula | C38H24N2O5 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.17 |
| IUPAC Name | 2,4,9-triphenoxy-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
| SMILES | O=c1c2cc(Oc3ccccc3)ccc2[nH]c2cc3c(=O)c4cc(Oc5ccccc5)cc(Oc5ccccc5)c4[nH]c3cc12 |
| InChI | InChI=1S/C38H24N2O5/c41-37-28-18-26(43-23-10-4-1-5-11-23)16-17-32(28)39-33-21-30-34(22-29(33)37)40-36-31(38(30)42)19-27(44-24-12-6-2-7-13-24)20-35(36)45-25-14-8-3-9-15-25/h1-22H,(H,39,41)(H,40,42) |
| InChIKey | NBSQAHJEZLIXSC-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|