C28H20N2O4 — CID 139796238
2,9-dimethoxy-5-phenyl-12H-quinolino[2,3-b]acridine-7,14-dione (PubChem CID 139796238) has the molecular formula C28H20N2O4 and a molecular weight of 448.48 g/mol. Its IUPAC name is 2,9-dimethoxy-5-phenyl-12H-quinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 2,9-dimethoxy-5-phenyl-12H-quinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 139796238 |
| Molecular Formula | C28H20N2O4 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 2,9-dimethoxy-5-phenyl-12H-quinolino[2,3-b]acridine-7,14-dione |
| SMILES | COc1ccc2[nH]c3cc4c(=O)c5cc(OC)ccc5n(-c5ccccc5)c4cc3c(=O)c2c1 |
| InChI | InChI=1S/C28H20N2O4/c1-33-17-8-10-23-19(12-17)27(31)20-15-26-22(14-24(20)29-23)28(32)21-13-18(34-2)9-11-25(21)30(26)16-6-4-3-5-7-16/h3-15H,1-2H3,(H,29,31) |
| InChIKey | SQYSNLKYAWERCE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|