C17H15NO2 — CID 15309879
8-methoxy-1,2,3,5-tetrahydrocyclopenta[b]acridin-10-one (PubChem CID 15309879) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is 8-methoxy-1,2,3,5-tetrahydrocyclopenta[b]acridin-10-one.
| Compound Name | 8-methoxy-1,2,3,5-tetrahydrocyclopenta[b]acridin-10-one |
|---|---|
| PubChem CID | 15309879 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 8-methoxy-1,2,3,5-tetrahydrocyclopenta[b]acridin-10-one |
| SMILES | COc1ccc2[nH]c3cc4c(cc3c(=O)c2c1)CCC4 |
| InChI | InChI=1S/C17H15NO2/c1-20-12-5-6-15-14(9-12)17(19)13-7-10-3-2-4-11(10)8-16(13)18-15/h5-9H,2-4H2,1H3,(H,18,19) |
| InChIKey | IPULRHIISIGSTB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|