C12H12N2NaO2 — CID 131885395
CID 131885395 (PubChem CID 131885395) has the molecular formula C12H12N2NaO2 and a molecular weight of 239.23 g/mol.
| Compound Name | CID 131885395 |
|---|---|
| PubChem CID | 131885395 |
| Molecular Formula | C12H12N2NaO2 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | — |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCNC3=O.[Na] |
| InChI | InChI=1S/C12H12N2O2.Na/c1-16-7-2-3-10-9(6-7)8-4-5-13-12(15)11(8)14-10;/h2-3,6,14H,4-5H2,1H3,(H,13,15); |
| InChIKey | UTYSKXLUSZXXEP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|