C20H19N3O2 — CID 24852332
(2Z)-2-(6-methoxy-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-ylidene)-2-phenylacetamide (PubChem CID 24852332) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is (2Z)-2-(6-methoxy-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-ylidene)-2-phenylacetamide.
| Compound Name | (2Z)-2-(6-methoxy-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-ylidene)-2-phenylacetamide |
|---|---|
| PubChem CID | 24852332 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (2Z)-2-(6-methoxy-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-ylidene)-2-phenylacetamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN/C3=C(\C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C20H19N3O2/c1-25-13-7-8-16-15(11-13)14-9-10-22-19(18(14)23-16)17(20(21)24)12-5-3-2-4-6-12/h2-8,11,22-23H,9-10H2,1H3,(H2,21,24)/b19-17- |
| InChIKey | NETXIDVTGLLBQQ-ZPHPHTNESA-N |
| XLogP | 2.68 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|