C14H15N3O2 — CID 136594970
2-(6-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)acetamide (PubChem CID 136594970) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-(6-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)acetamide.
| Compound Name | 2-(6-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)acetamide |
|---|---|
| PubChem CID | 136594970 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-(6-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)acetamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN=C3CC(N)=O |
| InChI | InChI=1S/C14H15N3O2/c1-19-8-2-3-11-10(6-8)9-4-5-16-12(7-13(15)18)14(9)17-11/h2-3,6,17H,4-5,7H2,1H3,(H2,15,18) |
| InChIKey | WORCKUCRQOGGHJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|