C14H14N2O3 — CID 137177310
2-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)acetic acid (PubChem CID 137177310) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 2-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)acetic acid.
| Compound Name | 2-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)acetic acid |
|---|---|
| PubChem CID | 137177310 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)acetic acid |
| SMILES | COc1ccc2c3c([nH]c2c1)C(CC(=O)O)=NCC3 |
| InChI | InChI=1S/C14H14N2O3/c1-19-8-2-3-9-10-4-5-15-12(7-13(17)18)14(10)16-11(9)6-8/h2-3,6,16H,4-5,7H2,1H3,(H,17,18) |
| InChIKey | GZFXSVVUFMDBNT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|