C27H28N4O2 — CID 155780424
7-methoxy-1-[3-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)propyl]-4,9-dihydro-3H-pyrido[3,4-b]indole (PubChem CID 155780424) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 7-methoxy-1-[3-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)propyl]-4,9-dihydro-3H-pyrido[3,4-b]indole.
| Compound Name | 7-methoxy-1-[3-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)propyl]-4,9-dihydro-3H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 155780424 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 7-methoxy-1-[3-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)propyl]-4,9-dihydro-3H-pyrido[3,4-b]indole |
| SMILES | COc1ccc2c3c([nH]c2c1)C(CCCC1=NCCc2c1[nH]c1cc(OC)ccc21)=NCC3 |
| InChI | InChI=1S/C27H28N4O2/c1-32-16-6-8-18-20-10-12-28-22(26(20)30-24(18)14-16)4-3-5-23-27-21(11-13-29-23)19-9-7-17(33-2)15-25(19)31-27/h6-9,14-15,30-31H,3-5,10-13H2,1-2H3 |
| InChIKey | LUQHXYAVMTWMRL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|