C33H29F3N4O2 — CID 162706973
7-methoxy-1-[3-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)-2-(2,4,5-trifluorophenyl)propyl]-4,9-dihydro-3H-pyrido[3,4-b]indole (PubChem CID 162706973) has the molecular formula C33H29F3N4O2 and a molecular weight of 570.62 g/mol. Its IUPAC name is 7-methoxy-1-[3-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)-2-(2,4,5-trifluorophenyl)propyl]-4,9-dihydro-3H-pyrido[3,4-b]indole.
| Compound Name | 7-methoxy-1-[3-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)-2-(2,4,5-trifluorophenyl)propyl]-4,9-dihydro-3H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 162706973 |
| Molecular Formula | C33H29F3N4O2 |
| Molecular Weight | 570.62 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | 7-methoxy-1-[3-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)-2-(2,4,5-trifluorophenyl)propyl]-4,9-dihydro-3H-pyrido[3,4-b]indole |
| SMILES | COc1ccc2c3c([nH]c2c1)C(CC(CC1=NCCc2c1[nH]c1cc(OC)ccc21)c1cc(F)c(F)cc1F)=NCC3 |
| InChI | InChI=1S/C33H29F3N4O2/c1-41-18-3-5-20-22-7-9-37-30(32(22)39-28(20)13-18)11-17(24-15-26(35)27(36)16-25(24)34)12-31-33-23(8-10-38-31)21-6-4-19(42-2)14-29(21)40-33/h3-6,13-17,39-40H,7-12H2,1-2H3 |
| InChIKey | RZOOSIHZMYUWOC-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.62 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|