C34H32N4O3 — CID 162706967
4-[1,3-bis(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)propan-2-yl]benzaldehyde (PubChem CID 162706967) has the molecular formula C34H32N4O3 and a molecular weight of 544.66 g/mol. Its IUPAC name is 4-[1,3-bis(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)propan-2-yl]benzaldehyde.
| Compound Name | 4-[1,3-bis(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)propan-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 162706967 |
| Molecular Formula | C34H32N4O3 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 4-[1,3-bis(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)propan-2-yl]benzaldehyde |
| SMILES | COc1ccc2c3c([nH]c2c1)C(CC(CC1=NCCc2c1[nH]c1cc(OC)ccc21)c1ccc(C=O)cc1)=NCC3 |
| InChI | InChI=1S/C34H32N4O3/c1-40-23-7-9-25-27-11-13-35-31(33(27)37-29(25)17-23)15-22(21-5-3-20(19-39)4-6-21)16-32-34-28(12-14-36-32)26-10-8-24(41-2)18-30(26)38-34/h3-10,17-19,22,37-38H,11-16H2,1-2H3 |
| InChIKey | JVAANCSWZHOVQH-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|