C13H14N2O2 — CID 137258618
(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)methanol (PubChem CID 137258618) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is (7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)methanol.
| Compound Name | (7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)methanol |
|---|---|
| PubChem CID | 137258618 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | (7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)methanol |
| SMILES | COc1ccc2c3c([nH]c2c1)C(CO)=NCC3 |
| InChI | InChI=1S/C13H14N2O2/c1-17-8-2-3-9-10-4-5-14-12(7-16)13(10)15-11(9)6-8/h2-3,6,15-16H,4-5,7H2,1H3 |
| InChIKey | OPLZSVSXSCYBAK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|