C24H28N2O2 — CID 164976882
2-[(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)methyl]-4,6-dimethyl-3-propan-2-ylphenol (PubChem CID 164976882) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-[(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)methyl]-4,6-dimethyl-3-propan-2-ylphenol.
| Compound Name | 2-[(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)methyl]-4,6-dimethyl-3-propan-2-ylphenol |
|---|---|
| PubChem CID | 164976882 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 2-[(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)methyl]-4,6-dimethyl-3-propan-2-ylphenol |
| SMILES | COc1ccc2c3c([nH]c2c1)C(Cc1c(O)c(C)cc(C)c1C(C)C)=NCC3 |
| InChI | InChI=1S/C24H28N2O2/c1-13(2)22-14(3)10-15(4)24(27)19(22)12-21-23-18(8-9-25-21)17-7-6-16(28-5)11-20(17)26-23/h6-7,10-11,13,26-27H,8-9,12H2,1-5H3 |
| InChIKey | HKOSNODDFLCWFX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|