C14H15NO2 — CID 12673419
2-methoxy-7,8,9,10-tetrahydro-5H-cyclohepta[b]indol-6-one (PubChem CID 12673419) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-methoxy-7,8,9,10-tetrahydro-5H-cyclohepta[b]indol-6-one.
| Compound Name | 2-methoxy-7,8,9,10-tetrahydro-5H-cyclohepta[b]indol-6-one |
|---|---|
| PubChem CID | 12673419 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-methoxy-7,8,9,10-tetrahydro-5H-cyclohepta[b]indol-6-one |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCCCC3=O |
| InChI | InChI=1S/C14H15NO2/c1-17-9-6-7-12-11(8-9)10-4-2-3-5-13(16)14(10)15-12/h6-8,15H,2-5H2,1H3 |
| InChIKey | NEYDQTQVCPXIMX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|