C13H15ClN2O — CID 135534458
6-methoxy-1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indole;hydrochloride (PubChem CID 135534458) has the molecular formula C13H15ClN2O and a molecular weight of 250.73 g/mol. Its IUPAC name is 6-methoxy-1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indole;hydrochloride.
| Compound Name | 6-methoxy-1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indole;hydrochloride |
|---|---|
| PubChem CID | 135534458 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 6-methoxy-1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indole;hydrochloride |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN=C3C.Cl |
| InChI | InChI=1S/C13H14N2O.ClH/c1-8-13-10(5-6-14-8)11-7-9(16-2)3-4-12(11)15-13;/h3-4,7,15H,5-6H2,1-2H3;1H |
| InChIKey | HCANWOZKXOUBFV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|