C14H17N2O+ — CID 102446924
6-methoxy-1,2-dimethyl-4,9-dihydro-3H-pyrido[3,4-b]indol-2-ium (PubChem CID 102446924) has the molecular formula C14H17N2O+ and a molecular weight of 229.30 g/mol. Its IUPAC name is 6-methoxy-1,2-dimethyl-4,9-dihydro-3H-pyrido[3,4-b]indol-2-ium.
| Compound Name | 6-methoxy-1,2-dimethyl-4,9-dihydro-3H-pyrido[3,4-b]indol-2-ium |
|---|---|
| PubChem CID | 102446924 |
| Molecular Formula | C14H17N2O+ |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 6-methoxy-1,2-dimethyl-4,9-dihydro-3H-pyrido[3,4-b]indol-2-ium |
| SMILES | COc1ccc2[nH]c3c(c2c1)CC[N+](C)=C3C |
| InChI | InChI=1S/C14H16N2O/c1-9-14-11(6-7-16(9)2)12-8-10(17-3)4-5-13(12)15-14/h4-5,8H,6-7H2,1-3H3/p+1 |
| InChIKey | TYDHHOFBPKGULB-UHFFFAOYSA-O |
| XLogP | 2.18 |
| TPSA | 28.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|