C25H21N2O5+ — CID 123459805
methyl 3-(2-hydroxybenzoyl)-9-methoxy-7,12-dihydro-6H-indolo[2,3-a]quinolizin-5-ium-1-carboxylate (PubChem CID 123459805) has the molecular formula C25H21N2O5+ and a molecular weight of 429.45 g/mol. Its IUPAC name is methyl 3-(2-hydroxybenzoyl)-9-methoxy-7,12-dihydro-6H-indolo[2,3-a]quinolizin-5-ium-1-carboxylate.
| Compound Name | methyl 3-(2-hydroxybenzoyl)-9-methoxy-7,12-dihydro-6H-indolo[2,3-a]quinolizin-5-ium-1-carboxylate |
|---|---|
| PubChem CID | 123459805 |
| Molecular Formula | C25H21N2O5+ |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | methyl 3-(2-hydroxybenzoyl)-9-methoxy-7,12-dihydro-6H-indolo[2,3-a]quinolizin-5-ium-1-carboxylate |
| SMILES | COC(=O)c1cc(C(=O)c2ccccc2O)c[n+]2c1-c1[nH]c3ccc(OC)cc3c1CC2 |
| InChI | InChI=1S/C25H20N2O5/c1-31-15-7-8-20-18(12-15)16-9-10-27-13-14(24(29)17-5-3-4-6-21(17)28)11-19(25(30)32-2)23(27)22(16)26-20/h3-8,11-13H,9-10H2,1-2H3,(H,28,29)/p+1 |
| InChIKey | JIJGJXXHCOHHRL-UHFFFAOYSA-O |
| XLogP | 3.41 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|