C20H20N2O2 — CID 113090173
(6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-(2-methylphenyl)methanone (PubChem CID 113090173) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is (6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-(2-methylphenyl)methanone.
| Compound Name | (6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 113090173 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-(2-methylphenyl)methanone |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(C(=O)c1ccccc1C)C3 |
| InChI | InChI=1S/C20H20N2O2/c1-13-5-3-4-6-15(13)20(23)22-10-9-16-17-11-14(24-2)7-8-18(17)21-19(16)12-22/h3-8,11,21H,9-10,12H2,1-2H3 |
| InChIKey | CGQPPYQKJGPDQD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|