C21H22N2O3 — CID 113090208
1-(6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-(4-methylphenoxy)ethanone (PubChem CID 113090208) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-(6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-(4-methylphenoxy)ethanone.
| Compound Name | 1-(6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-(4-methylphenoxy)ethanone |
|---|---|
| PubChem CID | 113090208 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1-(6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-(4-methylphenoxy)ethanone |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(C(=O)COc1ccc(C)cc1)C3 |
| InChI | InChI=1S/C21H22N2O3/c1-14-3-5-15(6-4-14)26-13-21(24)23-10-9-17-18-11-16(25-2)7-8-19(18)22-20(17)12-23/h3-8,11,22H,9-10,12-13H2,1-2H3 |
| InChIKey | BIXWEUWLUSTESR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|