C19H18N2O4 — CID 125433654
2-methyl-5-[2-oxo-2-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethoxy]pyran-4-one (PubChem CID 125433654) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-methyl-5-[2-oxo-2-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethoxy]pyran-4-one.
| Compound Name | 2-methyl-5-[2-oxo-2-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethoxy]pyran-4-one |
|---|---|
| PubChem CID | 125433654 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-methyl-5-[2-oxo-2-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethoxy]pyran-4-one |
| SMILES | Cc1cc(=O)c(OCC(=O)N2CCc3c([nH]c4ccccc34)C2)co1 |
| InChI | InChI=1S/C19H18N2O4/c1-12-8-17(22)18(10-24-12)25-11-19(23)21-7-6-14-13-4-2-3-5-15(13)20-16(14)9-21/h2-5,8,10,20H,6-7,9,11H2,1H3 |
| InChIKey | WDOAFUPGMHBRFW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 75.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|