C30H30N2O5 — CID 99990111
3-hydroxy-6-methyl-2-[(1R)-1-[4-(2-methylprop-2-enoxy)phenyl]-3-oxo-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propyl]pyran-4-one (PubChem CID 99990111) has the molecular formula C30H30N2O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is 3-hydroxy-6-methyl-2-[(1R)-1-[4-(2-methylprop-2-enoxy)phenyl]-3-oxo-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propyl]pyran-4-one.
| Compound Name | 3-hydroxy-6-methyl-2-[(1R)-1-[4-(2-methylprop-2-enoxy)phenyl]-3-oxo-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propyl]pyran-4-one |
|---|---|
| PubChem CID | 99990111 |
| Molecular Formula | C30H30N2O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 3-hydroxy-6-methyl-2-[(1R)-1-[4-(2-methylprop-2-enoxy)phenyl]-3-oxo-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propyl]pyran-4-one |
| SMILES | C=C(C)COc1ccc([C@@H](CC(=O)N2CCc3c([nH]c4ccccc34)C2)c2oc(C)cc(=O)c2O)cc1 |
| InChI | InChI=1S/C30H30N2O5/c1-18(2)17-36-21-10-8-20(9-11-21)24(30-29(35)27(33)14-19(3)37-30)15-28(34)32-13-12-23-22-6-4-5-7-25(22)31-26(23)16-32/h4-11,14,24,31,35H,1,12-13,15-17H2,2-3H3/t24-/m1/s1 |
| InChIKey | RCVMSSWYJVTEKB-XMMPIXPASA-N |
| XLogP | 5.20 |
| TPSA | 95.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|