C26H23ClN2O4 — CID 91638015
2-[1-(4-chlorophenyl)-3-oxo-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propyl]-3-hydroxy-6-methylpyran-4-one (PubChem CID 91638015) has the molecular formula C26H23ClN2O4 and a molecular weight of 462.93 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)-3-oxo-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propyl]-3-hydroxy-6-methylpyran-4-one.
| Compound Name | 2-[1-(4-chlorophenyl)-3-oxo-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propyl]-3-hydroxy-6-methylpyran-4-one |
|---|---|
| PubChem CID | 91638015 |
| Molecular Formula | C26H23ClN2O4 |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 2-[1-(4-chlorophenyl)-3-oxo-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propyl]-3-hydroxy-6-methylpyran-4-one |
| SMILES | Cc1cc(=O)c(O)c(C(CC(=O)N2CCc3c([nH]c4ccccc34)C2)c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C26H23ClN2O4/c1-15-12-23(30)25(32)26(33-15)20(16-6-8-17(27)9-7-16)13-24(31)29-11-10-19-18-4-2-3-5-21(18)28-22(19)14-29/h2-9,12,20,28,32H,10-11,13-14H2,1H3 |
| InChIKey | NRHSSOMRDAGKNE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 86.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|