C20H22O6 — CID 97424381
methyl (3R)-3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)-3-[4-(2-methylprop-2-enoxy)phenyl]propanoate (PubChem CID 97424381) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is methyl (3R)-3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)-3-[4-(2-methylprop-2-enoxy)phenyl]propanoate.
| Compound Name | methyl (3R)-3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)-3-[4-(2-methylprop-2-enoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 97424381 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | methyl (3R)-3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)-3-[4-(2-methylprop-2-enoxy)phenyl]propanoate |
| SMILES | C=C(C)COc1ccc([C@@H](CC(=O)OC)c2oc(C)cc(=O)c2O)cc1 |
| InChI | InChI=1S/C20H22O6/c1-12(2)11-25-15-7-5-14(6-8-15)16(10-18(22)24-4)20-19(23)17(21)9-13(3)26-20/h5-9,16,23H,1,10-11H2,2-4H3/t16-/m1/s1 |
| InChIKey | UIDXLGCSPCFYSC-MRXNPFEDSA-N |
| XLogP | 3.30 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|