C15H16O6 — CID 71826302
methyl 3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)-3-(5-methylfuran-2-yl)propanoate (PubChem CID 71826302) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is methyl 3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)-3-(5-methylfuran-2-yl)propanoate.
| Compound Name | methyl 3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)-3-(5-methylfuran-2-yl)propanoate |
|---|---|
| PubChem CID | 71826302 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | methyl 3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)-3-(5-methylfuran-2-yl)propanoate |
| SMILES | COC(=O)CC(c1ccc(C)o1)c1oc(C)cc(=O)c1O |
| InChI | InChI=1S/C15H16O6/c1-8-4-5-12(20-8)10(7-13(17)19-3)15-14(18)11(16)6-9(2)21-15/h4-6,10,18H,7H2,1-3H3 |
| InChIKey | VGJUBXWXZMFDHR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |