C20H18O6 — CID 71826838
methyl 3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)-3-(5-phenylfuran-2-yl)propanoate (PubChem CID 71826838) has the molecular formula C20H18O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is methyl 3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)-3-(5-phenylfuran-2-yl)propanoate.
| Compound Name | methyl 3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)-3-(5-phenylfuran-2-yl)propanoate |
|---|---|
| PubChem CID | 71826838 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | methyl 3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)-3-(5-phenylfuran-2-yl)propanoate |
| SMILES | COC(=O)CC(c1ccc(-c2ccccc2)o1)c1oc(C)cc(=O)c1O |
| InChI | InChI=1S/C20H18O6/c1-12-10-15(21)19(23)20(25-12)14(11-18(22)24-2)17-9-8-16(26-17)13-6-4-3-5-7-13/h3-10,14,23H,11H2,1-2H3 |
| InChIKey | QODFJZRJVYIKAA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |