C17H17FO6 — CID 97265333
methyl (3S)-3-(2-fluoro-4-methoxyphenyl)-3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)propanoate (PubChem CID 97265333) has the molecular formula C17H17FO6 and a molecular weight of 336.32 g/mol. Its IUPAC name is methyl (3S)-3-(2-fluoro-4-methoxyphenyl)-3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)propanoate.
| Compound Name | methyl (3S)-3-(2-fluoro-4-methoxyphenyl)-3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)propanoate |
|---|---|
| PubChem CID | 97265333 |
| Molecular Formula | C17H17FO6 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | methyl (3S)-3-(2-fluoro-4-methoxyphenyl)-3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)propanoate |
| SMILES | COC(=O)C[C@@H](c1ccc(OC)cc1F)c1oc(C)cc(=O)c1O |
| InChI | InChI=1S/C17H17FO6/c1-9-6-14(19)16(21)17(24-9)12(8-15(20)23-3)11-5-4-10(22-2)7-13(11)18/h4-7,12,21H,8H2,1-3H3/t12-/m0/s1 |
| InChIKey | GUZUVLSBHIUOPN-LBPRGKRZSA-N |
| XLogP | 2.50 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |