C16H14ClFO5 — CID 97265416
methyl (3R)-3-(3-chloro-4-fluorophenyl)-3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)propanoate (PubChem CID 97265416) has the molecular formula C16H14ClFO5 and a molecular weight of 340.73 g/mol. Its IUPAC name is methyl (3R)-3-(3-chloro-4-fluorophenyl)-3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)propanoate.
| Compound Name | methyl (3R)-3-(3-chloro-4-fluorophenyl)-3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)propanoate |
|---|---|
| PubChem CID | 97265416 |
| Molecular Formula | C16H14ClFO5 |
| Molecular Weight | 340.73 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | methyl (3R)-3-(3-chloro-4-fluorophenyl)-3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)propanoate |
| SMILES | COC(=O)C[C@H](c1ccc(F)c(Cl)c1)c1oc(C)cc(=O)c1O |
| InChI | InChI=1S/C16H14ClFO5/c1-8-5-13(19)15(21)16(23-8)10(7-14(20)22-2)9-3-4-12(18)11(17)6-9/h3-6,10,21H,7H2,1-2H3/t10-/m1/s1 |
| InChIKey | KJXRTCRTGLUWGD-SNVBAGLBSA-N |
| XLogP | 3.14 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.73 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |