C16H13F3O5 — CID 71706490
methyl 3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)-3-(2,3,4-trifluorophenyl)propanoate (PubChem CID 71706490) has the molecular formula C16H13F3O5 and a molecular weight of 342.27 g/mol. Its IUPAC name is methyl 3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)-3-(2,3,4-trifluorophenyl)propanoate.
| Compound Name | methyl 3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)-3-(2,3,4-trifluorophenyl)propanoate |
|---|---|
| PubChem CID | 71706490 |
| Molecular Formula | C16H13F3O5 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | methyl 3-(3-hydroxy-6-methyl-4-oxopyran-2-yl)-3-(2,3,4-trifluorophenyl)propanoate |
| SMILES | COC(=O)CC(c1ccc(F)c(F)c1F)c1oc(C)cc(=O)c1O |
| InChI | InChI=1S/C16H13F3O5/c1-7-5-11(20)15(22)16(24-7)9(6-12(21)23-2)8-3-4-10(17)14(19)13(8)18/h3-5,9,22H,6H2,1-2H3 |
| InChIKey | XWNVLNCFCOYCMF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|