C24H22N2O5 — CID 71753457
7-[2-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-oxoethoxy]-4-methylchromen-2-one (PubChem CID 71753457) has the molecular formula C24H22N2O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is 7-[2-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-oxoethoxy]-4-methylchromen-2-one.
| Compound Name | 7-[2-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-oxoethoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 71753457 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 7-[2-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-oxoethoxy]-4-methylchromen-2-one |
| SMILES | COc1ccc2[nH]c3c(c2c1)CN(C(=O)COc1ccc2c(C)cc(=O)oc2c1)CC3 |
| InChI | InChI=1S/C24H22N2O5/c1-14-9-24(28)31-22-11-16(3-5-17(14)22)30-13-23(27)26-8-7-21-19(12-26)18-10-15(29-2)4-6-20(18)25-21/h3-6,9-11,25H,7-8,12-13H2,1-2H3 |
| InChIKey | OLICTQMPOXPKQP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 84.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|