C19H17FN2O — CID 32836266
(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(2-methylphenyl)methanone (PubChem CID 32836266) has the molecular formula C19H17FN2O and a molecular weight of 308.36 g/mol. Its IUPAC name is (8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(2-methylphenyl)methanone.
| Compound Name | (8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 32836266 |
| Molecular Formula | C19H17FN2O |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)N1CCc2[nH]c3ccc(F)cc3c2C1 |
| InChI | InChI=1S/C19H17FN2O/c1-12-4-2-3-5-14(12)19(23)22-9-8-18-16(11-22)15-10-13(20)6-7-17(15)21-18/h2-7,10,21H,8-9,11H2,1H3 |
| InChIKey | HXQANAVMUDVONS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|