C18H13F3N2O — CID 141122655
1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl-(2,4,6-trifluorophenyl)methanone (PubChem CID 141122655) has the molecular formula C18H13F3N2O and a molecular weight of 330.31 g/mol. Its IUPAC name is 1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl-(2,4,6-trifluorophenyl)methanone.
| Compound Name | 1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl-(2,4,6-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 141122655 |
| Molecular Formula | C18H13F3N2O |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl-(2,4,6-trifluorophenyl)methanone |
| SMILES | O=C(c1c(F)cc(F)cc1F)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C18H13F3N2O/c19-10-7-13(20)17(14(21)8-10)18(24)23-6-5-16-12(9-23)11-3-1-2-4-15(11)22-16/h1-4,7-8,22H,5-6,9H2 |
| InChIKey | WRBCQBZTAHIBMV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|