C22H18ClFN4O — CID 43036837
[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone (PubChem CID 43036837) has the molecular formula C22H18ClFN4O and a molecular weight of 408.86 g/mol. Its IUPAC name is [5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone.
| Compound Name | [5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 43036837 |
| Molecular Formula | C22H18ClFN4O |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | [5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1C(=O)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C22H18ClFN4O/c1-13-20(21(23)28(26-13)15-8-6-14(24)7-9-15)22(29)27-11-10-19-17(12-27)16-4-2-3-5-18(16)25-19/h2-9,25H,10-12H2,1H3 |
| InChIKey | ITPKYSGEYKHRSO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|