C16H13ClN2O2 — CID 106686229
(2-chlorofuran-3-yl)-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone (PubChem CID 106686229) has the molecular formula C16H13ClN2O2 and a molecular weight of 300.75 g/mol. Its IUPAC name is (2-chlorofuran-3-yl)-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone.
| Compound Name | (2-chlorofuran-3-yl)-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 106686229 |
| Molecular Formula | C16H13ClN2O2 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | (2-chlorofuran-3-yl)-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
| SMILES | O=C(c1ccoc1Cl)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C16H13ClN2O2/c17-15-11(6-8-21-15)16(20)19-7-5-14-12(9-19)10-3-1-2-4-13(10)18-14/h1-4,6,8,18H,5,7,9H2 |
| InChIKey | SUXYPNKDFTYQPQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 49.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|